C13H18N2O4S — CID 63062115
3-methyl-N-[2-(2-nitrophenyl)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 63062115) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 3-methyl-N-[2-(2-nitrophenyl)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | 3-methyl-N-[2-(2-nitrophenyl)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 63062115 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-methyl-N-[2-(2-nitrophenyl)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | CC1(NCCc2ccccc2[N+](=O)[O-])CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18N2O4S/c1-13(7-9-20(18,19)10-13)14-8-6-11-4-2-3-5-12(11)15(16)17/h2-5,14H,6-10H2,1H3 |
| InChIKey | NZBXGCXNQUNBGT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|