C8H14F3NO3S — CID 115338117
1,1-dioxo-3-[2-(2,2,2-trifluoroethoxy)ethyl]thiolan-3-amine (PubChem CID 115338117) has the molecular formula C8H14F3NO3S and a molecular weight of 261.26 g/mol. Its IUPAC name is 1,1-dioxo-3-[2-(2,2,2-trifluoroethoxy)ethyl]thiolan-3-amine.
| Compound Name | 1,1-dioxo-3-[2-(2,2,2-trifluoroethoxy)ethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 115338117 |
| Molecular Formula | C8H14F3NO3S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 1,1-dioxo-3-[2-(2,2,2-trifluoroethoxy)ethyl]thiolan-3-amine |
| SMILES | NC1(CCOCC(F)(F)F)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14F3NO3S/c9-8(10,11)5-15-3-1-7(12)2-4-16(13,14)6-7/h1-6,12H2 |
| InChIKey | NDXWOEMMYFFQAM-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|