C8H14O5S — CID 66322761
3-(3-hydroxy-1,1-dioxothian-3-yl)propanoic acid (PubChem CID 66322761) has the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. Its IUPAC name is 3-(3-hydroxy-1,1-dioxothian-3-yl)propanoic acid.
| Compound Name | 3-(3-hydroxy-1,1-dioxothian-3-yl)propanoic acid |
|---|---|
| PubChem CID | 66322761 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-(3-hydroxy-1,1-dioxothian-3-yl)propanoic acid |
| SMILES | O=C(O)CCC1(O)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14O5S/c9-7(10)2-4-8(11)3-1-5-14(12,13)6-8/h11H,1-6H2,(H,9,10) |
| InChIKey | FJYFZIKALQJORU-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |