C7H9F3O3S — CID 130564591
1,1-dioxo-3-(3,3,3-trifluoroprop-1-en-2-yl)thiolan-3-ol (PubChem CID 130564591) has the molecular formula C7H9F3O3S and a molecular weight of 230.21 g/mol. Its IUPAC name is 1,1-dioxo-3-(3,3,3-trifluoroprop-1-en-2-yl)thiolan-3-ol.
| Compound Name | 1,1-dioxo-3-(3,3,3-trifluoroprop-1-en-2-yl)thiolan-3-ol |
|---|---|
| PubChem CID | 130564591 |
| Molecular Formula | C7H9F3O3S |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 1,1-dioxo-3-(3,3,3-trifluoroprop-1-en-2-yl)thiolan-3-ol |
| SMILES | C=C(C(F)(F)F)C1(O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H9F3O3S/c1-5(7(8,9)10)6(11)2-3-14(12,13)4-6/h11H,1-4H2 |
| InChIKey | XMFRVLDVZFPNSW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|