About 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one
5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one (PubChem CID 123845918) has the molecular formula C6H10ClNO2
and a molecular weight of 163.60 g/mol. Its IUPAC name is 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one |
| PubChem CID | 123845918 |
| Molecular Formula | C6H10ClNO2 |
| Molecular Weight | 163.60 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one |
| SMILES | CN1CC(C)(CCl)OC1=O |
| InChI | InChI=1S/C6H10ClNO2/c1-6(3-7)4-8(2)5(9)10-6/h3-4H2,1-2H3 |
| InChIKey | BAYMRUCESZUVRZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.60 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one?
The IUPAC name of 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one (CID 123845918) is 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one?
The canonical SMILES for 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one is CN1CC(C)(CCl)OC1=O.
What is the InChIKey of 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one?
The InChIKey is BAYMRUCESZUVRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10ClNO2/c1-6(3-7)4-8(2)5(9)10-6/h3-4H2,1-2H3.
What are the key properties of 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one?
5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one has a molecular weight of 163.60 g/mol, XLogP of 1.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-3,5-dimethyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 123845918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).