C10H18O5S — CID 73094971
(2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl) methanesulfonate (PubChem CID 73094971) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is (2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl) methanesulfonate.
| Compound Name | (2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl) methanesulfonate |
|---|---|
| PubChem CID | 73094971 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl) methanesulfonate |
| SMILES | CC1(C)OC2CCC(OS(C)(=O)=O)CC2O1 |
| InChI | InChI=1S/C10H18O5S/c1-10(2)13-8-5-4-7(6-9(8)14-10)15-16(3,11)12/h7-9H,4-6H2,1-3H3 |
| InChIKey | OANBFAPPQNXYOV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|