C27H46O4Si — CID 91579202
(2R,9S,16S)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,16-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-17-one (PubChem CID 91579202) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is (2R,9S,16S)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,16-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-17-one.
| Compound Name | (2R,9S,16S)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,16-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-17-one |
|---|---|
| PubChem CID | 91579202 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | (2R,9S,16S)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,16-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-17-one |
| SMILES | CC1(C)OC2C3C[C@@H](O[Si](C)(C)C(C)(C)C)CCC3C3CC[C@]4(C)C(=O)CCC4C3[C@H]2O1 |
| InChI | InChI=1S/C27H46O4Si/c1-25(2,3)32(7,8)31-16-9-10-17-18-13-14-27(6)20(11-12-21(27)28)22(18)24-23(19(17)15-16)29-26(4,5)30-24/h16-20,22-24H,9-15H2,1-8H3/t16-,17?,18?,19?,20?,22?,23?,24+,27-/m0/s1 |
| InChIKey | IZTAAPLOBOQUIY-FZBHBKDFSA-N |
| XLogP | 6.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|