C17H23NO — CID 102423902
7-methoxy-2,2-bis(prop-2-enyl)-1,3,4,5-tetrahydro-1-benzazepine (PubChem CID 102423902) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 7-methoxy-2,2-bis(prop-2-enyl)-1,3,4,5-tetrahydro-1-benzazepine.
| Compound Name | 7-methoxy-2,2-bis(prop-2-enyl)-1,3,4,5-tetrahydro-1-benzazepine |
|---|---|
| PubChem CID | 102423902 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 7-methoxy-2,2-bis(prop-2-enyl)-1,3,4,5-tetrahydro-1-benzazepine |
| SMILES | C=CCC1(CC=C)CCCc2cc(OC)ccc2N1 |
| InChI | InChI=1S/C17H23NO/c1-4-10-17(11-5-2)12-6-7-14-13-15(19-3)8-9-16(14)18-17/h4-5,8-9,13,18H,1-2,6-7,10-12H2,3H3 |
| InChIKey | FIHUTCVATPWXHJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|