C16H21N3O — CID 79496736
7-methoxy-1'-prop-2-enylspiro[2,3-dihydro-1H-naphthalene-4,5'-4H-imidazole]-2'-amine (PubChem CID 79496736) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 7-methoxy-1'-prop-2-enylspiro[2,3-dihydro-1H-naphthalene-4,5'-4H-imidazole]-2'-amine.
| Compound Name | 7-methoxy-1'-prop-2-enylspiro[2,3-dihydro-1H-naphthalene-4,5'-4H-imidazole]-2'-amine |
|---|---|
| PubChem CID | 79496736 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 7-methoxy-1'-prop-2-enylspiro[2,3-dihydro-1H-naphthalene-4,5'-4H-imidazole]-2'-amine |
| SMILES | C=CCN1C(N)=NCC12CCCc1cc(OC)ccc12 |
| InChI | InChI=1S/C16H21N3O/c1-3-9-19-15(17)18-11-16(19)8-4-5-12-10-13(20-2)6-7-14(12)16/h3,6-7,10H,1,4-5,8-9,11H2,2H3,(H2,17,18) |
| InChIKey | QPQNVCBEQLEMEN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|