C23H34O2 — CID 142090111
(8S,13R)-3-methoxy-9,13-dimethyl-8-propyl-6,7,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-16-ol (PubChem CID 142090111) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is (8S,13R)-3-methoxy-9,13-dimethyl-8-propyl-6,7,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-16-ol.
| Compound Name | (8S,13R)-3-methoxy-9,13-dimethyl-8-propyl-6,7,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-16-ol |
|---|---|
| PubChem CID | 142090111 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (8S,13R)-3-methoxy-9,13-dimethyl-8-propyl-6,7,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-16-ol |
| SMILES | CCC[C@@]12CCc3cc(OC)ccc3C1(C)CC[C@]1(C)CC(O)CC12 |
| InChI | InChI=1S/C23H34O2/c1-5-9-23-10-8-16-13-18(25-4)6-7-19(16)22(23,3)12-11-21(2)15-17(24)14-20(21)23/h6-7,13,17,20,24H,5,8-12,14-15H2,1-4H3/t17?,20?,21-,22?,23+/m1/s1 |
| InChIKey | JOWBJFWTRATPML-JZBUWDDVSA-N |
| XLogP | 5.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |