C23H30O2 — CID 134906351
(1R,2R,11S,14S,15R)-7-methoxy-2,11,14-trimethylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,16-tetraen-15-ol (PubChem CID 134906351) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is (1R,2R,11S,14S,15R)-7-methoxy-2,11,14-trimethylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,16-tetraen-15-ol.
| Compound Name | (1R,2R,11S,14S,15R)-7-methoxy-2,11,14-trimethylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,16-tetraen-15-ol |
|---|---|
| PubChem CID | 134906351 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (1R,2R,11S,14S,15R)-7-methoxy-2,11,14-trimethylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8,16-tetraen-15-ol |
| SMILES | COc1ccc2c(c1)CC[C@@]1(C)[C@]34C=C[C@](O)(CC3)[C@@]4(C)CC[C@]21C |
| InChI | InChI=1S/C23H30O2/c1-19-9-10-21(3)22(11-13-23(21,24)14-12-22)20(19,2)8-7-16-15-17(25-4)5-6-18(16)19/h5-6,11,13,15,24H,7-10,12,14H2,1-4H3/t19-,20-,21+,22+,23+/m1/s1 |
| InChIKey | GQNDHQMNAPETBD-VROINQGHSA-N |
| XLogP | 4.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|