C18H22O4 — CID 10662123
(1S,10R,13S)-6,13-dimethoxy-10-methyl-14-oxatetracyclo[11.2.1.01,10.04,9]hexadeca-4(9),5,7-trien-15-one (PubChem CID 10662123) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1S,10R,13S)-6,13-dimethoxy-10-methyl-14-oxatetracyclo[11.2.1.01,10.04,9]hexadeca-4(9),5,7-trien-15-one.
| Compound Name | (1S,10R,13S)-6,13-dimethoxy-10-methyl-14-oxatetracyclo[11.2.1.01,10.04,9]hexadeca-4(9),5,7-trien-15-one |
|---|---|
| PubChem CID | 10662123 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (1S,10R,13S)-6,13-dimethoxy-10-methyl-14-oxatetracyclo[11.2.1.01,10.04,9]hexadeca-4(9),5,7-trien-15-one |
| SMILES | COc1ccc2c(c1)CC[C@]13C[C@](OC)(CC[C@]21C)OC3=O |
| InChI | InChI=1S/C18H22O4/c1-16-8-9-18(21-3)11-17(16,15(19)22-18)7-6-12-10-13(20-2)4-5-14(12)16/h4-5,10H,6-9,11H2,1-3H3/t16-,17-,18+/m1/s1 |
| InChIKey | UFEAZSHSILODTL-KURKYZTESA-N |
| XLogP | 2.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |