C26H30BrNO — CID 10789791
(1R,10S,11S,12S)-14-(3-bromophenyl)-5-methoxy-12-methyl-11-prop-2-enyl-14-azatetracyclo[10.2.2.01,10.02,7]hexadeca-2(7),3,5-triene (PubChem CID 10789791) has the molecular formula C26H30BrNO and a molecular weight of 452.44 g/mol. Its IUPAC name is (1R,10S,11S,12S)-14-(3-bromophenyl)-5-methoxy-12-methyl-11-prop-2-enyl-14-azatetracyclo[10.2.2.01,10.02,7]hexadeca-2(7),3,5-triene.
| Compound Name | (1R,10S,11S,12S)-14-(3-bromophenyl)-5-methoxy-12-methyl-11-prop-2-enyl-14-azatetracyclo[10.2.2.01,10.02,7]hexadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 10789791 |
| Molecular Formula | C26H30BrNO |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | (1R,10S,11S,12S)-14-(3-bromophenyl)-5-methoxy-12-methyl-11-prop-2-enyl-14-azatetracyclo[10.2.2.01,10.02,7]hexadeca-2(7),3,5-triene |
| SMILES | C=CC[C@H]1[C@@H]2CCc3cc(OC)ccc3[C@@]23CC[C@]1(C)CN3c1cccc(Br)c1 |
| InChI | InChI=1S/C26H30BrNO/c1-4-6-23-24-11-9-18-15-21(29-3)10-12-22(18)26(24)14-13-25(23,2)17-28(26)20-8-5-7-19(27)16-20/h4-5,7-8,10,12,15-16,23-24H,1,6,9,11,13-14,17H2,2-3H3/t23-,24-,25+,26-/m0/s1 |
| InChIKey | HUKQASHSKBHUTF-SSUZURRFSA-N |
| XLogP | 6.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|