C14H17IO — CID 53473547
(1R,2R)-2-ethenyl-1-(iodomethyl)-6-methoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 53473547) has the molecular formula C14H17IO and a molecular weight of 328.19 g/mol. Its IUPAC name is (1R,2R)-2-ethenyl-1-(iodomethyl)-6-methoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R,2R)-2-ethenyl-1-(iodomethyl)-6-methoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 53473547 |
| Molecular Formula | C14H17IO |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | (1R,2R)-2-ethenyl-1-(iodomethyl)-6-methoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=C[C@H]1CCc2cc(OC)ccc2[C@@H]1CI |
| InChI | InChI=1S/C14H17IO/c1-3-10-4-5-11-8-12(16-2)6-7-13(11)14(10)9-15/h3,6-8,10,14H,1,4-5,9H2,2H3/t10-,14+/m0/s1 |
| InChIKey | GLDRAHMNQSQCIQ-IINYFYTJSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|