C17H21ClO — CID 102589450
(1R,2R)-1-(3-chlorobut-3-enyl)-2-ethenyl-6-methoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 102589450) has the molecular formula C17H21ClO and a molecular weight of 276.81 g/mol. Its IUPAC name is (1R,2R)-1-(3-chlorobut-3-enyl)-2-ethenyl-6-methoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R,2R)-1-(3-chlorobut-3-enyl)-2-ethenyl-6-methoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 102589450 |
| Molecular Formula | C17H21ClO |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (1R,2R)-1-(3-chlorobut-3-enyl)-2-ethenyl-6-methoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=C[C@H]1CCc2cc(OC)ccc2[C@@H]1CCC(=C)Cl |
| InChI | InChI=1S/C17H21ClO/c1-4-13-6-7-14-11-15(19-3)8-10-17(14)16(13)9-5-12(2)18/h4,8,10-11,13,16H,1-2,5-7,9H2,3H3/t13-,16+/m0/s1 |
| InChIKey | XGOHHJXUWGVYJG-XJKSGUPXSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|