C23H24O — CID 45103634
(1S,2S)-2-ethenyl-6-methoxy-1-(4-phenylbut-3-ynyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 45103634) has the molecular formula C23H24O and a molecular weight of 316.44 g/mol. Its IUPAC name is (1S,2S)-2-ethenyl-6-methoxy-1-(4-phenylbut-3-ynyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1S,2S)-2-ethenyl-6-methoxy-1-(4-phenylbut-3-ynyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 45103634 |
| Molecular Formula | C23H24O |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (1S,2S)-2-ethenyl-6-methoxy-1-(4-phenylbut-3-ynyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=C[C@@H]1CCc2cc(OC)ccc2[C@H]1CCC#Cc1ccccc1 |
| InChI | InChI=1S/C23H24O/c1-3-19-13-14-20-17-21(24-2)15-16-23(20)22(19)12-8-7-11-18-9-5-4-6-10-18/h3-6,9-10,15-17,19,22H,1,8,12-14H2,2H3/t19-,22+/m1/s1 |
| InChIKey | WUHJPDPPZCNLOP-KNQAVFIVSA-N |
| XLogP | 5.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|