C22H28O3 — CID 10382635
[(8S,9R,13R,14S,16R)-9-ethenyl-3-hydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 10382635) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is [(8S,9R,13R,14S,16R)-9-ethenyl-3-hydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [(8S,9R,13R,14S,16R)-9-ethenyl-3-hydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 10382635 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [(8S,9R,13R,14S,16R)-9-ethenyl-3-hydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | C=C[C@]12CC[C@]3(C)C[C@H](OC(C)=O)C[C@H]3[C@@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C22H28O3/c1-4-22-10-9-21(3)13-17(25-14(2)23)12-20(21)19(22)7-5-15-11-16(24)6-8-18(15)22/h4,6,8,11,17,19-20,24H,1,5,7,9-10,12-13H2,2-3H3/t17-,19+,20+,21-,22-/m1/s1 |
| InChIKey | VXBBTYWDZFXNRE-WHCFWRGISA-N |
| XLogP | 4.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|