C30H34ClNO6S — CID 16656854
[(7R,9R,13R,16R)-3-acetyloxy-9-ethenyl-7,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 16656854) has the molecular formula C30H34ClNO6S and a molecular weight of 572.12 g/mol. Its IUPAC name is [(7R,9R,13R,16R)-3-acetyloxy-9-ethenyl-7,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [(7R,9R,13R,16R)-3-acetyloxy-9-ethenyl-7,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16656854 |
| Molecular Formula | C30H34ClNO6S |
| Molecular Weight | 572.12 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | [(7R,9R,13R,16R)-3-acetyloxy-9-ethenyl-7,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | C=C[C@]12CC[C@]3(C)C[C@H](OC(=O)c4cc(S(N)(=O)=O)ccc4Cl)CC3C1C(C)Cc1cc(OC(C)=O)ccc12 |
| InChI | InChI=1S/C30H34ClNO6S/c1-5-30-11-10-29(4)16-21(38-28(34)23-15-22(39(32,35)36)7-9-26(23)31)14-25(29)27(30)17(2)12-19-13-20(37-18(3)33)6-8-24(19)30/h5-9,13,15,17,21,25,27H,1,10-12,14,16H2,2-4H3,(H2,32,35,36)/t17?,21-,25?,27?,29-,30-/m1/s1 |
| InChIKey | JQSRAHAGJXOYDL-DYZZBHIZSA-N |
| XLogP | 5.58 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.12 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|