C27H30FNO5S — CID 68811683
[(9R,13S,17S)-9-ethenyl-17-fluoro-3-hydroxy-13-methyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzoate (PubChem CID 68811683) has the molecular formula C27H30FNO5S and a molecular weight of 499.60 g/mol. Its IUPAC name is [(9R,13S,17S)-9-ethenyl-17-fluoro-3-hydroxy-13-methyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzoate.
| Compound Name | [(9R,13S,17S)-9-ethenyl-17-fluoro-3-hydroxy-13-methyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 68811683 |
| Molecular Formula | C27H30FNO5S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | [(9R,13S,17S)-9-ethenyl-17-fluoro-3-hydroxy-13-methyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzoate |
| SMILES | C=C[C@]12CC[C@@]3(C)C(CC[C@@]3(F)OC(=O)c3cccc(S(N)(=O)=O)c3)C1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C27H30FNO5S/c1-3-26-14-13-25(2)22(23(26)9-7-17-15-19(30)8-10-21(17)26)11-12-27(25,28)34-24(31)18-5-4-6-20(16-18)35(29,32)33/h3-6,8,10,15-16,22-23,30H,1,7,9,11-14H2,2H3,(H2,29,32,33)/t22?,23?,25-,26+,27+/m0/s1 |
| InChIKey | IZCXXMRBZBQJKB-UITHIGTGSA-N |
| XLogP | 4.76 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|