C19H22F2O3 — CID 87695789
(8S,9R,13S,14S,16R)-17,17-difluoro-3,16-dihydroxy-13-methyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-9-carbaldehyde (PubChem CID 87695789) has the molecular formula C19H22F2O3 and a molecular weight of 336.38 g/mol. Its IUPAC name is (8S,9R,13S,14S,16R)-17,17-difluoro-3,16-dihydroxy-13-methyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-9-carbaldehyde.
| Compound Name | (8S,9R,13S,14S,16R)-17,17-difluoro-3,16-dihydroxy-13-methyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-9-carbaldehyde |
|---|---|
| PubChem CID | 87695789 |
| Molecular Formula | C19H22F2O3 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (8S,9R,13S,14S,16R)-17,17-difluoro-3,16-dihydroxy-13-methyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-9-carbaldehyde |
| SMILES | C[C@]12CC[C@]3(C=O)c4ccc(O)cc4CC[C@H]3[C@@H]1C[C@@H](O)C2(F)F |
| InChI | InChI=1S/C19H22F2O3/c1-17-6-7-18(10-22)13-5-3-12(23)8-11(13)2-4-14(18)15(17)9-16(24)19(17,20)21/h3,5,8,10,14-16,23-24H,2,4,6-7,9H2,1H3/t14-,15-,16+,17-,18-/m0/s1 |
| InChIKey | NRVZSMLSHNVZBD-JCECYMMASA-N |
| XLogP | 3.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|