C16H23NO — CID 70512173
(4aR,10bR)-10b-propyl-2,3,4,4a,5,6-hexahydro-1H-benzo[f]isoquinolin-9-ol (PubChem CID 70512173) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (4aR,10bR)-10b-propyl-2,3,4,4a,5,6-hexahydro-1H-benzo[f]isoquinolin-9-ol.
| Compound Name | (4aR,10bR)-10b-propyl-2,3,4,4a,5,6-hexahydro-1H-benzo[f]isoquinolin-9-ol |
|---|---|
| PubChem CID | 70512173 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (4aR,10bR)-10b-propyl-2,3,4,4a,5,6-hexahydro-1H-benzo[f]isoquinolin-9-ol |
| SMILES | CCC[C@@]12CCNC[C@@H]1CCc1ccc(O)cc12 |
| InChI | InChI=1S/C16H23NO/c1-2-7-16-8-9-17-11-13(16)5-3-12-4-6-14(18)10-15(12)16/h4,6,10,13,17-18H,2-3,5,7-9,11H2,1H3/t13-,16+/m0/s1 |
| InChIKey | DKFZSSZEDQFROU-XJKSGUPXSA-N |
| XLogP | 2.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |