C35H48O4 — CID 144765105
ethane;[17-ethenoxy-13-methyl-15-(3-oxobutyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 144765105) has the molecular formula C35H48O4 and a molecular weight of 532.77 g/mol. Its IUPAC name is ethane;[17-ethenoxy-13-methyl-15-(3-oxobutyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | ethane;[17-ethenoxy-13-methyl-15-(3-oxobutyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 144765105 |
| Molecular Formula | C35H48O4 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | ethane;[17-ethenoxy-13-methyl-15-(3-oxobutyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C=COC1CC(CCC(C)=O)C2C3CCc4cc(OC(=O)c5ccccc5)ccc4C3CCC12C.CC.CC |
| InChI | InChI=1S/C31H36O4.2C2H6/c1-4-34-28-19-23(11-10-20(2)32)29-27-14-12-22-18-24(35-30(33)21-8-6-5-7-9-21)13-15-25(22)26(27)16-17-31(28,29)3;2*1-2/h4-9,13,15,18,23,26-29H,1,10-12,14,16-17,19H2,2-3H3;2*1-2H3 |
| InChIKey | LMMFWUUTUUHADQ-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|