C24H34O3 — CID 144765122
(17-methoxy-13-methyl-15-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) acetate (PubChem CID 144765122) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is (17-methoxy-13-methyl-15-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) acetate.
| Compound Name | (17-methoxy-13-methyl-15-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) acetate |
|---|---|
| PubChem CID | 144765122 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (17-methoxy-13-methyl-15-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) acetate |
| SMILES | CCCC1CC(OC)C2(C)CCC3c4ccc(OC(C)=O)cc4CCC3C12 |
| InChI | InChI=1S/C24H34O3/c1-5-6-17-14-22(26-4)24(3)12-11-20-19-10-8-18(27-15(2)25)13-16(19)7-9-21(20)23(17)24/h8,10,13,17,20-23H,5-7,9,11-12,14H2,1-4H3 |
| InChIKey | ZENUQDKHYCPDSB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|