C33H48O6 — CID 10370065
methyl (8R,9S,13S,14S)-3-methoxy-13-methyl-16-[7-(oxan-2-yloxy)heptyl]-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-16-carboxylate (PubChem CID 10370065) has the molecular formula C33H48O6 and a molecular weight of 540.74 g/mol. Its IUPAC name is methyl (8R,9S,13S,14S)-3-methoxy-13-methyl-16-[7-(oxan-2-yloxy)heptyl]-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-16-carboxylate.
| Compound Name | methyl (8R,9S,13S,14S)-3-methoxy-13-methyl-16-[7-(oxan-2-yloxy)heptyl]-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-16-carboxylate |
|---|---|
| PubChem CID | 10370065 |
| Molecular Formula | C33H48O6 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | methyl (8R,9S,13S,14S)-3-methoxy-13-methyl-16-[7-(oxan-2-yloxy)heptyl]-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-16-carboxylate |
| SMILES | COC(=O)C1(CCCCCCCOC2CCCCO2)C[C@H]2[C@@H]3CCc4cc(OC)ccc4[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C33H48O6/c1-32-18-16-26-25-15-13-24(36-2)21-23(25)12-14-27(26)28(32)22-33(30(32)34,31(35)37-3)17-8-5-4-6-9-19-38-29-11-7-10-20-39-29/h13,15,21,26-29H,4-12,14,16-20,22H2,1-3H3/t26-,27-,28+,29?,32+,33?/m1/s1 |
| InChIKey | VBVLPXJDELAJDB-JRQLEJSSSA-N |
| XLogP | 6.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|