C54H94O6Si — CID 11513474
(8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-16,16-bis[10-(oxan-2-yloxy)decyl]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 11513474) has the molecular formula C54H94O6Si and a molecular weight of 867.43 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-16,16-bis[10-(oxan-2-yloxy)decyl]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-16,16-bis[10-(oxan-2-yloxy)decyl]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 11513474 |
| Molecular Formula | C54H94O6Si |
| Molecular Weight | 867.43 g/mol |
| Exact Mass | 866.68 |
| IUPAC Name | (8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-16,16-bis[10-(oxan-2-yloxy)decyl]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC(CCCCCCCCCCOC1CCCCO1)(CCCCCCCCCCOC1CCCCO1)[C@@H]2O |
| InChI | InChI=1S/C54H94O6Si/c1-52(2,3)61(5,6)60-44-30-32-45-43(41-44)29-31-47-46(45)33-36-53(4)48(47)42-54(51(53)55,34-21-15-11-7-9-13-17-23-37-56-49-27-19-25-39-58-49)35-22-16-12-8-10-14-18-24-38-57-50-28-20-26-40-59-50/h30,32,41,46-51,55H,7-29,31,33-40,42H2,1-6H3/t46-,47-,48+,49?,50?,51-,53+,54?/m1/s1 |
| InChIKey | CATKSCHJPUOWER-UPWUVBKDSA-N |
| XLogP | 14.99 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.43 |
| LogP ≤ 5 | 14.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|