C33H46F6O5 — CID 126713283
2-[4-[[(8R,9S,13S,14S,17S)-17-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]butoxy]oxane (PubChem CID 126713283) has the molecular formula C33H46F6O5 and a molecular weight of 636.71 g/mol. Its IUPAC name is 2-[4-[[(8R,9S,13S,14S,17S)-17-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]butoxy]oxane.
| Compound Name | 2-[4-[[(8R,9S,13S,14S,17S)-17-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]butoxy]oxane |
|---|---|
| PubChem CID | 126713283 |
| Molecular Formula | C33H46F6O5 |
| Molecular Weight | 636.71 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | 2-[4-[[(8R,9S,13S,14S,17S)-17-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]butoxy]oxane |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCCCOC5CCCCO5)cc4CC[C@H]3[C@@H]1CC[C@@H]2OCCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C33H46F6O5/c1-31-15-14-25-24-11-9-23(40-16-4-5-18-43-29-7-2-3-17-42-29)21-22(24)8-10-26(25)27(31)12-13-28(31)41-19-6-20-44-30(32(34,35)36)33(37,38)39/h9,11,21,25-30H,2-8,10,12-20H2,1H3/t25-,26-,27+,28+,29?,31+/m1/s1 |
| InChIKey | RESYHDRDVWBYMN-BGOKVBCASA-N |
| XLogP | 8.53 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.71 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|