C35H51F6NO5S2 — CID 145238031
[17-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] N-[1,4-bis(sulfanyl)butan-2-yl]-N-(6-hydroxyhexyl)carbamate (PubChem CID 145238031) has the molecular formula C35H51F6NO5S2 and a molecular weight of 743.92 g/mol. Its IUPAC name is [17-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] N-[1,4-bis(sulfanyl)butan-2-yl]-N-(6-hydroxyhexyl)carbamate.
| Compound Name | [17-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] N-[1,4-bis(sulfanyl)butan-2-yl]-N-(6-hydroxyhexyl)carbamate |
|---|---|
| PubChem CID | 145238031 |
| Molecular Formula | C35H51F6NO5S2 |
| Molecular Weight | 743.92 g/mol |
| Exact Mass | 743.31 |
| IUPAC Name | [17-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] N-[1,4-bis(sulfanyl)butan-2-yl]-N-(6-hydroxyhexyl)carbamate |
| SMILES | CC12CCC3c4ccc(OC(=O)N(CCCCCCO)C(CS)CCS)cc4CCC3C1CCC2OCCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C35H51F6NO5S2/c1-33-15-13-27-26-10-8-25(47-32(44)42(24(22-49)14-20-48)16-4-2-3-5-17-43)21-23(26)7-9-28(27)29(33)11-12-30(33)45-18-6-19-46-31(34(36,37)38)35(39,40)41/h8,10,21,24,27-31,43,48-49H,2-7,9,11-20,22H2,1H3 |
| InChIKey | KQZXXTBANLJWCB-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.92 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|