C36H54N2O5S — CID 70002404
[(8S,9S,11S,13S,14S,17S)-17-hydroxy-8,13-dimethyl-11-[4-[7-[methyl(propan-2-yl)amino]heptoxy]phenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 70002404) has the molecular formula C36H54N2O5S and a molecular weight of 626.90 g/mol. Its IUPAC name is [(8S,9S,11S,13S,14S,17S)-17-hydroxy-8,13-dimethyl-11-[4-[7-[methyl(propan-2-yl)amino]heptoxy]phenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(8S,9S,11S,13S,14S,17S)-17-hydroxy-8,13-dimethyl-11-[4-[7-[methyl(propan-2-yl)amino]heptoxy]phenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 70002404 |
| Molecular Formula | C36H54N2O5S |
| Molecular Weight | 626.90 g/mol |
| Exact Mass | 626.38 |
| IUPAC Name | [(8S,9S,11S,13S,14S,17S)-17-hydroxy-8,13-dimethyl-11-[4-[7-[methyl(propan-2-yl)amino]heptoxy]phenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | CC(C)N(C)CCCCCCCOc1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@H]3O)[C@]3(C)CCc4cc(OS(N)(=O)=O)ccc4[C@@H]23)cc1 |
| InChI | InChI=1S/C36H54N2O5S/c1-25(2)38(5)21-9-7-6-8-10-22-42-28-13-11-26(12-14-28)31-24-36(4)32(17-18-33(36)39)35(3)20-19-27-23-29(43-44(37,40)41)15-16-30(27)34(31)35/h11-16,23,25,31-34,39H,6-10,17-22,24H2,1-5H3,(H2,37,40,41)/t31-,32+,33+,34+,35+,36+/m1/s1 |
| InChIKey | FKDHZIXSEOCRRG-WXSFHFDCSA-N |
| XLogP | 6.94 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.90 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|