C28H37F3O3 — CID 69105153
(9S,11S,13S,14S,17S)-8-ethenyl-13-methyl-11-[(6R)-7,8,8-trifluoro-6-hydroxyoct-7-enyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 69105153) has the molecular formula C28H37F3O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is (9S,11S,13S,14S,17S)-8-ethenyl-13-methyl-11-[(6R)-7,8,8-trifluoro-6-hydroxyoct-7-enyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (9S,11S,13S,14S,17S)-8-ethenyl-13-methyl-11-[(6R)-7,8,8-trifluoro-6-hydroxyoct-7-enyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 69105153 |
| Molecular Formula | C28H37F3O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | (9S,11S,13S,14S,17S)-8-ethenyl-13-methyl-11-[(6R)-7,8,8-trifluoro-6-hydroxyoct-7-enyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C=CC12CCc3cc(O)ccc3[C@H]1[C@@H](CCCCC[C@@H](O)C(F)=C(F)F)C[C@]1(C)[C@@H](O)CC[C@@H]21 |
| InChI | InChI=1S/C28H37F3O3/c1-3-28-14-13-17-15-19(32)9-10-20(17)24(28)18(16-27(2)22(28)11-12-23(27)34)7-5-4-6-8-21(33)25(29)26(30)31/h3,9-10,15,18,21-24,32-34H,1,4-8,11-14,16H2,2H3/t18-,21+,22+,23-,24+,27-,28?/m0/s1 |
| InChIKey | QTDPPRYQNIHXLL-VERLJVSFSA-N |
| XLogP | 6.78 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|