C29H38F7NO4S — CID 142774665
[(6R)-7,7,8,8,9,9,9-heptafluoro-6-hydroxynonyl] N-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamate (PubChem CID 142774665) has the molecular formula C29H38F7NO4S and a molecular weight of 629.68 g/mol. Its IUPAC name is [(6R)-7,7,8,8,9,9,9-heptafluoro-6-hydroxynonyl] N-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamate.
| Compound Name | [(6R)-7,7,8,8,9,9,9-heptafluoro-6-hydroxynonyl] N-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamate |
|---|---|
| PubChem CID | 142774665 |
| Molecular Formula | C29H38F7NO4S |
| Molecular Weight | 629.68 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | [(6R)-7,7,8,8,9,9,9-heptafluoro-6-hydroxynonyl] N-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamate |
| SMILES | C=C[C@@]12CCc3cc(NS(=O)(=O)OCCCCC[C@@H](O)C(F)(F)C(F)(F)C(F)(F)F)ccc3[C@H]1CC[C@]1(C)CCC[C@H]12 |
| InChI | InChI=1S/C29H38F7NO4S/c1-3-26-16-12-19-18-20(10-11-21(19)22(26)13-15-25(2)14-7-8-23(25)26)37-42(39,40)41-17-6-4-5-9-24(38)27(30,31)28(32,33)29(34,35)36/h3,10-11,18,22-24,37-38H,1,4-9,12-17H2,2H3/t22-,23-,24-,25+,26-/m1/s1 |
| InChIKey | QGCURASDGZMULU-LFEPYJTBSA-N |
| XLogP | 7.92 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.68 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|