C33H52O4Si — CID 69105240
6-[(8R,9S,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]hexanoic acid (PubChem CID 69105240) has the molecular formula C33H52O4Si and a molecular weight of 540.86 g/mol. Its IUPAC name is 6-[(8R,9S,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]hexanoic acid.
| Compound Name | 6-[(8R,9S,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]hexanoic acid |
|---|---|
| PubChem CID | 69105240 |
| Molecular Formula | C33H52O4Si |
| Molecular Weight | 540.86 g/mol |
| Exact Mass | 540.36 |
| IUPAC Name | 6-[(8R,9S,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]hexanoic acid |
| SMILES | C=C[C@@]12CCc3cc(OC)ccc3[C@H]1[C@@H](CCCCCC(=O)O)C[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]12 |
| InChI | InChI=1S/C33H52O4Si/c1-9-33-20-19-23-21-25(36-6)15-16-26(23)30(33)24(13-11-10-12-14-29(34)35)22-32(5)27(33)17-18-28(32)37-38(7,8)31(2,3)4/h9,15-16,21,24,27-28,30H,1,10-14,17-20,22H2,2-8H3,(H,34,35)/t24-,27+,28-,30+,32-,33-/m0/s1 |
| InChIKey | HQTXOLOCHPUEFY-VQUCGHEBSA-N |
| XLogP | 8.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.86 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|