C26H42O2Si — CID 59257807
(7R,11S,13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-7,11,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 59257807) has the molecular formula C26H42O2Si and a molecular weight of 414.71 g/mol. Its IUPAC name is (7R,11S,13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-7,11,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (7R,11S,13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-7,11,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 59257807 |
| Molecular Formula | C26H42O2Si |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (7R,11S,13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-7,11,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CC1Cc2cc(O[Si](C)(C)C(C)(C)C)ccc2C2C1C1CC[C@H](O)[C@@]1(C)C[C@@H]2C |
| InChI | InChI=1S/C26H42O2Si/c1-16-13-18-14-19(28-29(7,8)25(3,4)5)9-10-20(18)23-17(2)15-26(6)21(24(16)23)11-12-22(26)27/h9-10,14,16-17,21-24,27H,11-13,15H2,1-8H3/t16?,17-,21?,22-,23?,24?,26-/m0/s1 |
| InChIKey | KTNNVKGAFYXNLC-AYTUXHSUSA-N |
| XLogP | 6.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|