C24H38O3 — CID 71173516
(2R,4R)-4-[[(4aS,10aS)-7-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl]methoxy]pentan-2-ol (PubChem CID 71173516) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is (2R,4R)-4-[[(4aS,10aS)-7-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl]methoxy]pentan-2-ol.
| Compound Name | (2R,4R)-4-[[(4aS,10aS)-7-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl]methoxy]pentan-2-ol |
|---|---|
| PubChem CID | 71173516 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (2R,4R)-4-[[(4aS,10aS)-7-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl]methoxy]pentan-2-ol |
| SMILES | COc1ccc2c(c1)CC[C@H]1C(C)(C)C(CO[C@H](C)C[C@@H](C)O)CC[C@]21C |
| InChI | InChI=1S/C24H38O3/c1-16(25)13-17(2)27-15-19-11-12-24(5)21-9-8-20(26-6)14-18(21)7-10-22(24)23(19,3)4/h8-9,14,16-17,19,22,25H,7,10-13,15H2,1-6H3/t16-,17-,19?,22+,24-/m1/s1 |
| InChIKey | FDKGTRMGQSLBCE-GDLQSYDMSA-N |
| XLogP | 5.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |