C22H32O2 — CID 10892811
[(2R,4aS)-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl] acetate (PubChem CID 10892811) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is [(2R,4aS)-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl] acetate.
| Compound Name | [(2R,4aS)-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 10892811 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | [(2R,4aS)-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)c3ccc(C(C)C)cc3CCC2C1(C)C |
| InChI | InChI=1S/C22H32O2/c1-14(2)16-7-9-18-17(13-16)8-10-19-21(4,5)20(24-15(3)23)11-12-22(18,19)6/h7,9,13-14,19-20H,8,10-12H2,1-6H3/t19?,20-,22-/m1/s1 |
| InChIKey | CGCMREBLRQFVLX-NQUCAWMESA-N |
| XLogP | 5.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |