C22H30O4 — CID 127038495
[(2S,4aS,10aR)-7-acetyl-6-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl] acetate (PubChem CID 127038495) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(2S,4aS,10aR)-7-acetyl-6-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl] acetate.
| Compound Name | [(2S,4aS,10aR)-7-acetyl-6-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 127038495 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(2S,4aS,10aR)-7-acetyl-6-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl] acetate |
| SMILES | COc1cc2c(cc1C(C)=O)CC[C@H]1C(C)(C)[C@@H](OC(C)=O)CC[C@]21C |
| InChI | InChI=1S/C22H30O4/c1-13(23)16-11-15-7-8-19-21(3,4)20(26-14(2)24)9-10-22(19,5)17(15)12-18(16)25-6/h11-12,19-20H,7-10H2,1-6H3/t19-,20-,22+/m0/s1 |
| InChIKey | UOJAKYGTEIZJMA-JAXLGGSGSA-N |
| XLogP | 4.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |