C19H29NO — CID 155632379
(4bR,8aS,9S)-N-ethyl-3-methoxy-N,4b-dimethyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-amine (PubChem CID 155632379) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (4bR,8aS,9S)-N-ethyl-3-methoxy-N,4b-dimethyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-amine.
| Compound Name | (4bR,8aS,9S)-N-ethyl-3-methoxy-N,4b-dimethyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-amine |
|---|---|
| PubChem CID | 155632379 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (4bR,8aS,9S)-N-ethyl-3-methoxy-N,4b-dimethyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-amine |
| SMILES | CCN(C)[C@H]1Cc2ccc(OC)cc2[C@]2(C)CCCC[C@H]12 |
| InChI | InChI=1S/C19H29NO/c1-5-20(3)18-12-14-9-10-15(21-4)13-17(14)19(2)11-7-6-8-16(18)19/h9-10,13,16,18H,5-8,11-12H2,1-4H3/t16-,18+,19-/m1/s1 |
| InChIKey | BXZCMDMSOUUDCC-NZSAHSFTSA-N |
| XLogP | 4.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |