C20H26O — CID 139385883
(1S,13S,14R)-4-methoxy-12-methylpentacyclo[8.8.0.01,14.02,7.09,13]octadeca-2(7),3,5-triene (PubChem CID 139385883) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is (1S,13S,14R)-4-methoxy-12-methylpentacyclo[8.8.0.01,14.02,7.09,13]octadeca-2(7),3,5-triene.
| Compound Name | (1S,13S,14R)-4-methoxy-12-methylpentacyclo[8.8.0.01,14.02,7.09,13]octadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 139385883 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (1S,13S,14R)-4-methoxy-12-methylpentacyclo[8.8.0.01,14.02,7.09,13]octadeca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@H]1C(C)CC3C1C2 |
| InChI | InChI=1S/C20H26O/c1-12-9-18-15-10-13-6-7-14(21-2)11-17(13)20(18)8-4-3-5-16(20)19(12)15/h6-7,11-12,15-16,18-19H,3-5,8-10H2,1-2H3/t12?,15?,16-,18?,19+,20+/m1/s1 |
| InChIKey | DYIPOUUDIVWPKX-RBUCOXTBSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |