C26H30N2O2 — CID 145186977
4-methoxy-N-[(1R,9R,13R,14R)-12-methyl-12-azapentacyclo[8.8.0.01,14.02,7.09,13]octadeca-2(7),3,5-trien-4-yl]benzamide (PubChem CID 145186977) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 4-methoxy-N-[(1R,9R,13R,14R)-12-methyl-12-azapentacyclo[8.8.0.01,14.02,7.09,13]octadeca-2(7),3,5-trien-4-yl]benzamide.
| Compound Name | 4-methoxy-N-[(1R,9R,13R,14R)-12-methyl-12-azapentacyclo[8.8.0.01,14.02,7.09,13]octadeca-2(7),3,5-trien-4-yl]benzamide |
|---|---|
| PubChem CID | 145186977 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 4-methoxy-N-[(1R,9R,13R,14R)-12-methyl-12-azapentacyclo[8.8.0.01,14.02,7.09,13]octadeca-2(7),3,5-trien-4-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)[C@@]24CCCC[C@H]2[C@H]2[C@H](C3)C4CN2C)cc1 |
| InChI | InChI=1S/C26H30N2O2/c1-28-15-23-20-13-17-6-9-18(27-25(29)16-7-10-19(30-2)11-8-16)14-22(17)26(23)12-4-3-5-21(26)24(20)28/h6-11,14,20-21,23-24H,3-5,12-13,15H2,1-2H3,(H,27,29)/t20-,21+,23?,24-,26-/m1/s1 |
| InChIKey | HRHAQFKNEWNFML-IMANYTQKSA-N |
| XLogP | 4.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |