C20H22N2O2 — CID 7085029
N-[(4bS,8aR)-5,6,7,8,8a,9-hexahydro-4bH-carbazol-2-yl]-4-methoxybenzamide (PubChem CID 7085029) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[(4bS,8aR)-5,6,7,8,8a,9-hexahydro-4bH-carbazol-2-yl]-4-methoxybenzamide.
| Compound Name | N-[(4bS,8aR)-5,6,7,8,8a,9-hexahydro-4bH-carbazol-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 7085029 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-[(4bS,8aR)-5,6,7,8,8a,9-hexahydro-4bH-carbazol-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)N[C@@H]2CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C20H22N2O2/c1-24-15-9-6-13(7-10-15)20(23)21-14-8-11-17-16-4-2-3-5-18(16)22-19(17)12-14/h6-12,16,18,22H,2-5H2,1H3,(H,21,23)/t16-,18+/m0/s1 |
| InChIKey | LBDJUXTWZRBICZ-FUHWJXTLSA-N |
| XLogP | 4.40 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |