C29H30N2O4 — CID 22982781
N-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-4-methoxybenzamide (PubChem CID 22982781) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-4-methoxybenzamide.
| Compound Name | N-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 22982781 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(C3=N[C@@H]4CCCC[C@@H]4c4cc(OC)c(OC)cc43)c2)cc1 |
| InChI | InChI=1S/C29H30N2O4/c1-33-21-13-11-18(12-14-21)29(32)30-20-8-6-7-19(15-20)28-24-17-27(35-3)26(34-2)16-23(24)22-9-4-5-10-25(22)31-28/h6-8,11-17,22,25H,4-5,9-10H2,1-3H3,(H,30,32)/t22-,25-/m1/s1 |
| InChIKey | YCUBJZLBINQLCF-RCZVLFRGSA-N |
| XLogP | 5.84 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |