C29H29NO4 — CID 11775420
[4-(8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]-(3-methoxyphenyl)methanone (PubChem CID 11775420) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is [4-(8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]-(3-methoxyphenyl)methanone.
| Compound Name | [4-(8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 11775420 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | [4-(8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)c2ccc(C3=NC4CCCCC4c4cc(OC)c(OC)cc43)cc2)c1 |
| InChI | InChI=1S/C29H29NO4/c1-32-21-8-6-7-20(15-21)29(31)19-13-11-18(12-14-19)28-24-17-27(34-3)26(33-2)16-23(24)22-9-4-5-10-25(22)30-28/h6-8,11-17,22,25H,4-5,9-10H2,1-3H3 |
| InChIKey | XICGKLUXEALXSX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |