C28H29N3O2 — CID 87928327
[[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-phenylmethylidene]hydrazine (PubChem CID 87928327) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is [[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-phenylmethylidene]hydrazine.
| Compound Name | [[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-phenylmethylidene]hydrazine |
|---|---|
| PubChem CID | 87928327 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | [[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-phenylmethylidene]hydrazine |
| SMILES | COc1cc2c(cc1OC)[C@H]1CCCC[C@H]1N=C2c1ccc(C(=NN)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29N3O2/c1-32-25-16-22-21-10-6-7-11-24(21)30-28(23(22)17-26(25)33-2)20-14-12-19(13-15-20)27(31-29)18-8-4-3-5-9-18/h3-5,8-9,12-17,21,24H,6-7,10-11,29H2,1-2H3/t21-,24-/m1/s1 |
| InChIKey | RAEWDNZPHSIASE-ZJSXRUAMSA-N |
| XLogP | 5.29 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|