C22H22ClNO3 — CID 87929319
4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]benzoyl chloride (PubChem CID 87929319) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is 4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]benzoyl chloride.
| Compound Name | 4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]benzoyl chloride |
|---|---|
| PubChem CID | 87929319 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]benzoyl chloride |
| SMILES | COc1cc2c(cc1OC)[C@H]1CCCC[C@H]1N=C2c1ccc(C(=O)Cl)cc1 |
| InChI | InChI=1S/C22H22ClNO3/c1-26-19-11-16-15-5-3-4-6-18(15)24-21(17(16)12-20(19)27-2)13-7-9-14(10-8-13)22(23)25/h7-12,15,18H,3-6H2,1-2H3/t15-,18-/m1/s1 |
| InChIKey | FULPDEPORCXZAS-CRAIPNDOSA-N |
| XLogP | 4.96 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|