C27H34N2O3 — CID 91102513
1-[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-(2-methylpropoxy)ethenamine (PubChem CID 91102513) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is 1-[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-(2-methylpropoxy)ethenamine.
| Compound Name | 1-[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-(2-methylpropoxy)ethenamine |
|---|---|
| PubChem CID | 91102513 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 1-[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-(2-methylpropoxy)ethenamine |
| SMILES | C=C(NOCC(C)C)c1ccc(C2=N[C@@H]3CCCC[C@@H]3c3cc(OC)c(OC)cc32)cc1 |
| InChI | InChI=1S/C27H34N2O3/c1-17(2)16-32-29-18(3)19-10-12-20(13-11-19)27-23-15-26(31-5)25(30-4)14-22(23)21-8-6-7-9-24(21)28-27/h10-15,17,21,24,29H,3,6-9,16H2,1-2,4-5H3/t21-,24-/m1/s1 |
| InChIKey | MZLARZSKTUSNTQ-ZJSXRUAMSA-N |
| XLogP | 5.73 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|