C24H28N2O3 — CID 87926835
(E)-1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-methoxyethanimine (PubChem CID 87926835) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (E)-1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-methoxyethanimine.
| Compound Name | (E)-1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 87926835 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (E)-1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-methoxyethanimine |
| SMILES | CO/N=C(\C)c1cccc(C2=N[C@@H]3CCCC[C@@H]3c3cc(OC)c(OC)cc32)c1 |
| InChI | InChI=1S/C24H28N2O3/c1-15(26-29-4)16-8-7-9-17(12-16)24-20-14-23(28-3)22(27-2)13-19(20)18-10-5-6-11-21(18)25-24/h7-9,12-14,18,21H,5-6,10-11H2,1-4H3/b26-15+/t18-,21-/m1/s1 |
| InChIKey | KJWIQARDXHFSLY-SGFBMDDESA-N |
| XLogP | 4.95 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|