C30H32N2O6S — CID 54456812
methyl 4-[[4-[(4aR,10bR)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]sulfamoyl]benzoate (PubChem CID 54456812) has the molecular formula C30H32N2O6S and a molecular weight of 548.66 g/mol. Its IUPAC name is methyl 4-[[4-[(4aR,10bR)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[[4-[(4aR,10bR)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 54456812 |
| Molecular Formula | C30H32N2O6S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | methyl 4-[[4-[(4aR,10bR)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]sulfamoyl]benzoate |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccc(NS(=O)(=O)c3ccc(C(=O)OC)cc3)cc1)=N[C@@H]1CCCC[C@H]21 |
| InChI | InChI=1S/C30H32N2O6S/c1-4-38-28-17-24-23-7-5-6-8-26(23)31-29(25(24)18-27(28)36-2)19-9-13-21(14-10-19)32-39(34,35)22-15-11-20(12-16-22)30(33)37-3/h9-18,23,26,32H,4-8H2,1-3H3/t23-,26-/m1/s1 |
| InChIKey | WYTQFBXQLATLGM-ZEQKJWHPSA-N |
| XLogP | 5.56 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |