C35H36N2O6S2 — CID 86755880
N-[4-[(4aS,10bS)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide (PubChem CID 86755880) has the molecular formula C35H36N2O6S2 and a molecular weight of 644.82 g/mol. Its IUPAC name is N-[4-[(4aS,10bS)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide.
| Compound Name | N-[4-[(4aS,10bS)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 86755880 |
| Molecular Formula | C35H36N2O6S2 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | N-[4-[(4aS,10bS)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide |
| SMILES | COc1cc2c(cc1OC)[C@@H]1CCCC[C@@H]1N=C2c1ccc(N(S(=O)(=O)c2ccc(C)cc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C35H36N2O6S2/c1-23-9-17-27(18-10-23)44(38,39)37(45(40,41)28-19-11-24(2)12-20-28)26-15-13-25(14-16-26)35-31-22-34(43-4)33(42-3)21-30(31)29-7-5-6-8-32(29)36-35/h9-22,29,32H,5-8H2,1-4H3/t29-,32-/m0/s1 |
| InChIKey | IXYBJLXWWJBJIF-NYDCQLBNSA-N |
| XLogP | 6.78 |
| TPSA | 102.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |