C24H24F2N4O2 — CID 87782198
(4aR,10bR)-9-(2,2-difluoroethoxy)-6-(6-imidazol-1-yl-3-pyridinyl)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridine (PubChem CID 87782198) has the molecular formula C24H24F2N4O2 and a molecular weight of 438.48 g/mol. Its IUPAC name is (4aR,10bR)-9-(2,2-difluoroethoxy)-6-(6-imidazol-1-yl-3-pyridinyl)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridine.
| Compound Name | (4aR,10bR)-9-(2,2-difluoroethoxy)-6-(6-imidazol-1-yl-3-pyridinyl)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridine |
|---|---|
| PubChem CID | 87782198 |
| Molecular Formula | C24H24F2N4O2 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (4aR,10bR)-9-(2,2-difluoroethoxy)-6-(6-imidazol-1-yl-3-pyridinyl)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridine |
| SMILES | COc1cc2c(cc1OCC(F)F)[C@H]1CCCC[C@H]1N=C2c1ccc(-n2ccnc2)nc1 |
| InChI | InChI=1S/C24H24F2N4O2/c1-31-20-11-18-17(10-21(20)32-13-22(25)26)16-4-2-3-5-19(16)29-24(18)15-6-7-23(28-12-15)30-9-8-27-14-30/h6-12,14,16,19,22H,2-5,13H2,1H3/t16-,19-/m1/s1 |
| InChIKey | SOJOAKIIZPNSAB-VQIMIIECSA-N |
| XLogP | 4.80 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |