C27H29N3O4 — CID 86614323
[9-ethoxy-6-(4-imidazol-1-ylphenyl)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate (PubChem CID 86614323) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is [9-ethoxy-6-(4-imidazol-1-ylphenyl)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate.
| Compound Name | [9-ethoxy-6-(4-imidazol-1-ylphenyl)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate |
|---|---|
| PubChem CID | 86614323 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | [9-ethoxy-6-(4-imidazol-1-ylphenyl)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccc(-n3ccnc3)cc1)=NC1CCC(OC(C)=O)CC21 |
| InChI | InChI=1S/C27H29N3O4/c1-4-33-26-14-21-22-13-20(34-17(2)31)9-10-24(22)29-27(23(21)15-25(26)32-3)18-5-7-19(8-6-18)30-12-11-28-16-30/h5-8,11-12,14-16,20,22,24H,4,9-10,13H2,1-3H3 |
| InChIKey | XVMCREADTSRFQO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |