C48H52N4O10 — CID 67022770
bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(1-methyl-6-oxo-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] (E)-but-2-enedioate (PubChem CID 67022770) has the molecular formula C48H52N4O10 and a molecular weight of 844.96 g/mol. Its IUPAC name is bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(1-methyl-6-oxo-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] (E)-but-2-enedioate.
| Compound Name | bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(1-methyl-6-oxo-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 67022770 |
| Molecular Formula | C48H52N4O10 |
| Molecular Weight | 844.96 g/mol |
| Exact Mass | 844.37 |
| IUPAC Name | bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(1-methyl-6-oxo-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] (E)-but-2-enedioate |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccc(=O)n(C)c1)=N[C@@H]1CC[C@@H](OC(=O)/C=C/C(=O)O[C@@H]3CC[C@H]4N=C(c5ccc(=O)n(C)c5)c5cc(OC)c(OCC)cc5[C@H]4C3)C[C@H]21 |
| InChI | InChI=1S/C48H52N4O10/c1-7-59-41-21-31-33-19-29(11-13-37(33)49-47(35(31)23-39(41)57-5)27-9-15-43(53)51(3)25-27)61-45(55)17-18-46(56)62-30-12-14-38-34(20-30)32-22-42(60-8-2)40(58-6)24-36(32)48(50-38)28-10-16-44(54)52(4)26-28/h9-10,15-18,21-26,29-30,33-34,37-38H,7-8,11-14,19-20H2,1-6H3/b18-17+/t29-,30-,33-,34-,37-,38-/m1/s1 |
| InChIKey | UMAPYDOJIBIKPQ-CKJBWERUSA-N |
| XLogP | 5.95 |
| TPSA | 158.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.96 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|